|
|
|
MINERAL CLASSIFICATION / SYSTEMATIK der MINERALE based on E.H. Nickel & M.C. Nichols (2009), H. Strunz & E.H. Nickel (2001), revised by Thomas Witzke (2024) 3. HALIDES (Fluorides, Chlorides, Bromides, Iodides) 3.D: Oxyhalides and Hydroxyhalides | ||||||||||||||||||
3.DA. Oxyhalides and Hydroxyhalides with Al | ||||||||||||||||||
3.DA.005. Zharchikhite | ||||||||||||||||||
Zharchikhite | AlF(OH)2 | mon., P21/a | IMA 1986-059 | |||||||||||||||
Zharchikhite: crystal structure not known. | ||||||||||||||||||
| ||||||||||||||||||
3.DB. Oxyhalides and Hydroxyhalides with Cu (and/or Mg, Mn, Fe, Zn), without Pb | ||||||||||||||||||
3.DB.005. Melanothallite | ||||||||||||||||||
Melanothallite | Cu2OCl2 | orth., Fddd | G | |||||||||||||||
Melanothallite: three-dimensional framework of cross-linking chains of edge-sharing CuO2Cl2 squares. | ||||||||||||||||||
3.DB.010. Ponomarevite | ||||||||||||||||||
Ponomarevite | K4Cu4OCl10 | mon., C2/c | FOTO | G | ||||||||||||||
Ponomarevite: clusters of four five-fold polyhedra. | ||||||||||||||||||
3.DB.015. Korshunovskite | ||||||||||||||||||
Korshunovskite | Mg2(OH)3Cl·4H2O | tric., P1 or P1 | FOTO | G | ||||||||||||||
Korshunovskite: ribbons of edge-sharing MgX6 octahedra. The ribbons are two octahedra wide. | ||||||||||||||||||
3.DB.020. Muonionalustaite | ||||||||||||||||||
Muonionalustaite | Ni2(OH)3Cl·4H2O | mon., C2/m | FOTO | IMA 2020-010 | ||||||||||||||
Muonionalustaite: ribbons of edge-sharing NiX6 octahedra. The ribbons are three octahedra wide. | ||||||||||||||||||
3.DB.025. Nepskoeite | ||||||||||||||||||
Nepskoeite | Mg4(OH)7Cl·6H2O | orth., Pcmm (?) | IMA 1996-016 | |||||||||||||||
3.DB.030. Khaidarkanite | ||||||||||||||||||
Khaidarkanite | Cu4Al3(OH)14F3·2H2O | mon., C2/m | IMA 1998-013 | |||||||||||||||
Khaidarkanite: ribbons of edge-sharing octahedra. The two outer chains are built up of Cu-centered octahedra, the inner chain of Al-centered octahedra. | ||||||||||||||||||
3.DB.035. Botallackite group | ||||||||||||||||||
035 a. Botallackite series | ||||||||||||||||||
Botallackite | Cu2(OH)3Cl | mon., P21/m | FOTO | G | ||||||||||||||
Iyoite | CuMn(OH)3Cl | mon., P21/m | IMA 2013-130 | |||||||||||||||
Belloite | Cu(OH)Cl | mon., P21/a | FOTO | IMA 1998-054 | ||||||||||||||
035 b. Kapellasite series | ||||||||||||||||||
Haydeeite | Cu3Mg(OH)6Cl2 | trig., P3m1 | IMA 2006-046 | |||||||||||||||
Kapellasite | Cu3Zn(OH)6Cl2 | trig., P3m1 | IMA 2005-009 | |||||||||||||||
Misakiite | Cu3Mn(OH)6Cl2 | trig., P3m1 | IMA 2013-131 | |||||||||||||||
Botallackite: trioctahedral layers of distorted edge-sharing CuX6 octahedra. | ||||||||||||||||||
3.DB.040. Centennialite | ||||||||||||||||||
Centennialite | Cu3Ca(OH)6Cl2·n H2O (n ca. 0.7) | trig., P3 | IMA 2013-110 | |||||||||||||||
Centennialite: layers of distorted edge-sharing CuX6 octahedra and CaO6 octahedra. | ||||||||||||||||||
3.DB.045. Claringbullite group | ||||||||||||||||||
Claringbullite | Cu4FCl(OH)6 | hex., P63/mmc | IMA 1976-029, Rd | |||||||||||||||
Barlowite | Cu4FBr(OH)6 | hex., P63/mmc | IMA 2010-020 | |||||||||||||||
3.DB.050. Simonkolleite | ||||||||||||||||||
Simonkolleite | Zn5(OH)8Cl2·H2O | trig., R3m | FOTO | IMA 1983-019 | ||||||||||||||
Simonkolleite: dioctahedral layers of edge-sharing ZnX6 octahedra, with ZnX4 tetrahedra above and belov the vacant positions. Structurally related to Gordaite. | ||||||||||||||||||
3.DB.055. Calumetite | ||||||||||||||||||
Calumetite | CaCu4(OH)8Cl2·3.5H2O | orth., Cmcm | Rd | |||||||||||||||
Calumetite, originally thought to be Cu(OH,Cl)2·2H2O, was redefined as CaCu4(OH)8Cl2·3.5H2O. Vondechenite (IMA 2016-065) was found to be identical with the redefined calumetite and was discredited (IMA 2018-C). | ||||||||||||||||||
3.DB.060. Dioskouriite | ||||||||||||||||||
Dioskouriite | CaCu4(OH)4Cl6·4H2O | mon., P21/c | IMA 2015-106 | |||||||||||||||
Dioskouriite polytypes: Dioskouriite-2M (mon., P21/c), Dioskouriite-2O (orth., , P212121). The structure contains layers of octahedra and square pyramids. | ||||||||||||||||||
3.DB.065. Avdoninite | ||||||||||||||||||
Avdoninite | K2Cu5(OH)4Cl8·H2O | mon., P2/m or P21/m | FOTO | IMA 2005-046a | ||||||||||||||
Avdoninite: layers of octahedra and square pyramids. | ||||||||||||||||||
3.DB.070. Feodosiyite | ||||||||||||||||||
Feodosiyite | Cu11Mg2(OH)8Cl18·16H2O | mon., P21/c | IMA 2015-063 | |||||||||||||||
Feodosiyite: layers formed of a network of distorted edge-sharing octahedra Cu(OH)2Cl4, Cu(OH)3Cl3 and Cu(OH)2(H2O)Cl3 and distorted tetragonal pyramids Cu(OH)2Cl3. Interlayer with isolated Mg(H2O)6 octahedra and additional water. | ||||||||||||||||||
3.DB.075. Bounahasite | ||||||||||||||||||
Bounahasite | Cu+Cu2+2(OH)3Cl2 | mon., P21/n | IMA 2022-005 | |||||||||||||||
Bounahasite: structure of two alternating layers. One layer contains ribbons of alternating, edge-sharing CuO6 octahedra and CuO4 squares. The ribbons are connected to layers by edge-sharing CuO4 squares. The other layer is built of dimers of edge-sharing CuClCuO4 tetrahedra, forming Cu2Cl6 dimers. The dimers are connected to a layer via shared vertices. | ||||||||||||||||||
3.DB.080. Romanorlovite | ||||||||||||||||||
Romanorlovite | K8Cu6(OH)3Cl17 | tetr., I4/mmm | IMA 2014-011 | |||||||||||||||
3.DB.085. Chrysothallite | ||||||||||||||||||
Chrysothallite | K6Cu6Tl3+(OH)4Cl17·H2O | tetr., I4/mmm | IMA 2013-008 | |||||||||||||||
3.DB.090. Atacamite group | ||||||||||||||||||
Atacamite | Cu2(OH)3Cl | orth., Pnam | FOTO | G | ||||||||||||||
Hibbingite | Fe2(OH)3Cl | orth., Pnam | IMA 1991-036 | |||||||||||||||
Kempite | Mn2(OH)3Cl | orth., Pnam | G | |||||||||||||||
Atacamite: layers formed of a network of distorted edge-sharing octahedra (formally dioctahedral, but the arrangement of the octahedra is different from the layers in dioctahedral micas etc.). The layers are connected by octahedra to a three-dimensional network. | ||||||||||||||||||
3.DB.095. Clinoatacamite group | ||||||||||||||||||
095 a. Clinoatacamite series | ||||||||||||||||||
Clinoatacamite | Cu2(OH)3Cl | mon., P21/n | FOTO | IMA 1993-060 | ||||||||||||||
095 b. Paratacamite series | ||||||||||||||||||
Paratacamite | Cu3Cu(OH)6Cl2 | trig., R3 | FOTO | G | ||||||||||||||
Paratacamite-(Mg) | Cu3(Mg,Cu)(OH)6Cl2 | trig., R3 | IMA 2013-014 | |||||||||||||||
Paratacamite-(Ni) | Cu3(Ni,Cu)(OH)6Cl2 | trig., R3 | IMA 2013-013 | |||||||||||||||
095 c. Herbertsmithite series | ||||||||||||||||||
Tondiite | Cu3Mg(OH)6Cl2 | trig., R3m | IMA 2013-077 | |||||||||||||||
Herbertsmithite | Cu3Zn(OH)6Cl2 | trig., R3m | FOTO | IMA 2003-041 | ||||||||||||||
Gillardite | Cu3Ni(OH)6Cl2 | trig., R3m | FOTO | IMA 2006-041 | ||||||||||||||
Leverettite | Cu3Co(OH)6Cl2 | trig., R3m | IMA 2013-011 | |||||||||||||||
095 d. Kuliginite | ||||||||||||||||||
Kuliginite | Fe3Mg(OH)6Cl2 | trig., R3 | IMA 2016-049 | |||||||||||||||
095 e. Parahibbingite | ||||||||||||||||||
Parahibbingite | Fe2(OH)3Cl | trig., R3m | IMA 2020-038a | |||||||||||||||
Clinoatacamite and Paratacamite: layers formed of a network of distorted edge-sharing octahedra (formally dioctahedral, but the arrangement of the octahedra is different from the layers in dioctahedral micas etc.). The layers are connected by octahedra to a three-dimensional network. | ||||||||||||||||||
3.DB.100. Bobkingite | ||||||||||||||||||
Bobkingite | Cu5(OH)8Cl2·2H2O | mon., C2/m | IMA 2000-029 | |||||||||||||||
3.DB.105. Connellite group | ||||||||||||||||||
Buttgenbachite | Cu36Cl6(NO3)2(OH)64·nH2O | hex., P63/mmc | FOTO | G | ||||||||||||||
Connellite | Cu36Cl8(SO4)(OH)62·6H2O | hex., P62c or P63 | FOTO | G | ||||||||||||||
3.DB.110. Anthonyite | ||||||||||||||||||
Anthonyite | Cu(OH,Cl)2·3H2O | mon. | A | |||||||||||||||
Anthonyite: crystal structure not known. | ||||||||||||||||||
| ||||||||||||||||||
3.DC. Oxyhalides and Hydroxyhalides with Pb and Cu, Ag or Fe | ||||||||||||||||||
3.DC.005. Diaboleite | ||||||||||||||||||
Diaboleite | Pb2Cu(OH)4Cl2 | tetr., P4mm | FOTO | G | ||||||||||||||
3.DC.010. Pseudoboleite | ||||||||||||||||||
Pseudoboleite | Pb31Cu24(OH)48Cl62 | tetr., I4/mmm | FOTO | G | ||||||||||||||
3.DC.015. Cumengeite | ||||||||||||||||||
Cumengeite | Pb21Cu20(OH)40Cl42 | tetr., I4/mmm | G | |||||||||||||||
3.DC.020. Siidraite | ||||||||||||||||||
Siidraite | Pb2Cu(OH)2I3 | orth., Fddd | IMA 2016-039 | |||||||||||||||
3.DC.025. Chloroxiphite | ||||||||||||||||||
Chloroxiphite | Pb3CuO2Cl2 | mon., P21/m | FOTO | G | ||||||||||||||
3.DC.030. Boleite | ||||||||||||||||||
Boleite | KAg9Pb26Cu24(OH)48Cl62 | cub., Pm3m | FOTO | G | ||||||||||||||
3.DC.035. Bideauxite | ||||||||||||||||||
Bideauxite | AgPb2(F,OH)2Cl3 | cub., Fd3m | IMA 1969-038 | |||||||||||||||
3.DC.040. Hematophanite | ||||||||||||||||||
Hematophanite | Pb4Fe3O8Cl | tetr., P4mm | G | |||||||||||||||
3.DC.045. Murdochite group | ||||||||||||||||||
Murdochite | Pb2Cu12O15Cl2 | cub., Fm3m | FOTO | G | ||||||||||||||
Eddavidite | Pb2Cu12O15Br2 | cub., Fm3m | IMA 2018-018 | |||||||||||||||
| ||||||||||||||||||
3.DD. Oxyhalides and Hydroxyhalides with Pb (or Sb, Bi, Sn), without Cu | ||||||||||||||||||
3.DD.005. Onoratoite | ||||||||||||||||||
Onoratoite | Sb8O11Cl2 | mon., C2/m | FOTO | IMA 1967-057 | ||||||||||||||
3.DD.010. Bismoclite group | ||||||||||||||||||
Zavaritskite | BiOF | tetr., P4/nmm | FOTO | A | ||||||||||||||
Bismoclite | BiOCl | tetr., P4/nmm | FOTO | G | ||||||||||||||
Daubréeite | BiO(OH,Cl) | tetr., P4/nmm | FOTO | G | ||||||||||||||
Isostructural with the Matlockite group. | ||||||||||||||||||
3.DD.015. Abhurite | ||||||||||||||||||
Abhurite | Sn21O6(OH)14Cl16 | trig., R32 | FOTO | G | ||||||||||||||
3.DD.020. Laurionite group | ||||||||||||||||||
Laurionite | Pb(OH)Cl | orth., Pcmn | FOTO | A | ||||||||||||||
Paralaurionite | Pb(OH)Cl | mon., C2/m | FOTO | A | ||||||||||||||
3.DD.025. Penfieldite | ||||||||||||||||||
Penfieldite | Pb2Cl3(OH) | hex., P6 | FOTO | G | ||||||||||||||
3.DD.030. Yeomanite | ||||||||||||||||||
Yeomanite | Pb2O(OH)Cl | orth., Pnma | IMA 2013-024 | |||||||||||||||
3.DD.035. Mendipite | ||||||||||||||||||
Mendipite | Pb3O2Cl2 | orth., Pbnm | FOTO | G | ||||||||||||||
3.DD.040. Damaraite | ||||||||||||||||||
Damaraite | Pb4O3Cl2 | orth., Pma2 or other | IMA 1989-013 | |||||||||||||||
3.DD.045. Blixite | ||||||||||||||||||
Blixite | Pb8O5(OH)2Cl4 | mon., C2/c | A | |||||||||||||||
3.DD.050. Fiedlerite | ||||||||||||||||||
Fiedlerite | Pb3(OH)FCl4·2H2O | tric., P1 | FOTO | G | ||||||||||||||
Fiedlerite polytypes: Fiedlerite-1A (tric., P1), Fiedlerite-2M (mon., P21/a). | ||||||||||||||||||
3.DD.055. Manuelarossiite | ||||||||||||||||||
Manuelarossiite | PbCaAlF7 | mon., C2/m | IMA 2022-097 | |||||||||||||||
3.DD.055. Aravaipaite group | ||||||||||||||||||
Aravaipaite | Pb3AlF9·H2O | tric., P1 or P1 | FOTO | IMA 1988-021 | ||||||||||||||
Calcioaravaipaite | PbCa2Al(F,OH)9 | tric., C1 | IMA 1994-018 | |||||||||||||||
3.DD.060. Yedlinite | ||||||||||||||||||
Yedlinite | Pb6CrCl6(OH,O)8 | trig., R3 | IMA 1974-001 | |||||||||||||||
3.DD.065. Rickturnerite | ||||||||||||||||||
Rickturnerite | Pb7O4[Mg(OH)4](OH)Cl3 | orth., Pnma | IMA 2010-034 | |||||||||||||||
3.DD.070. Barstowite | ||||||||||||||||||
Barstowite | Pb4(CO3)Cl6 | mon., P21/m | IMA 1989-057 | |||||||||||||||
| ||||||||||||||||||
3.DE. Layered Pb-Oxyhalides with (substituted) PbO-layers derived from litharge / massicot | ||||||||||||||||||
3.DE.005. Rumseyite | ||||||||||||||||||
Rumseyite | [Pb2OF]Cl | tetr., I4/mmm | IMA 2011-091 | |||||||||||||||
3.DE.010. Napoliite | ||||||||||||||||||
Napoliite | [Pb2OF]Cl | tetr., P42/mcm | IMA 2022-073 | |||||||||||||||
3.DE.015. Nadorite group | ||||||||||||||||||
Nadorite | PbSbO2Cl | orth., Bmmb | FOTO | G | ||||||||||||||
Perite | PbBiO2Cl | orth., Bmmb | A | |||||||||||||||
Telluroperite | Pb3TeO4Cl2 | orth., Bmmb | IMA 2009-044 | |||||||||||||||
3.DE.020. Thorikosite | ||||||||||||||||||
Thorikosite | Pb3(Sb0.6As0.4)O3.5(OH)Cl2 | tetr., I4/mmm | FOTO | IMA 1984-013 | ||||||||||||||
3.DE.025. Ecdemite | ||||||||||||||||||
Ecdemite | Pb6As3+2O7Cl4 | tetr. | G | |||||||||||||||
3.DE.030. Pinalite | ||||||||||||||||||
Pinalite | Pb3WO5Cl2 | orth., Amam | IMA 1988-025 | |||||||||||||||
3.DE.035. Schwartzembergite | ||||||||||||||||||
Schwartzembergite | Pb5H2IO6Cl3 | orth., Fmmm or other | G | |||||||||||||||
3.DE.040. Symesite | ||||||||||||||||||
Symesite | Pb10O7(SO4)Cl4 | tric., B1 | A | |||||||||||||||
3.DE.045. Sundiusite | ||||||||||||||||||
Sundiusite | Pb10O8(SO4)Cl10 | mon., C2 or other | IMA 1979-044 | |||||||||||||||
Sundiusite shows probably some structural relation to the nadorite group. | ||||||||||||||||||
3.DE.050. Sahlinite group | ||||||||||||||||||
Sahlinite | Pb14O9(AsO4)2Cl4 | mon., C2/c | G | |||||||||||||||
Kombatite | Pb14O9(VO4)2Cl4 | mon., C2/c | IMA 1985-056 | |||||||||||||||
3.DE.055. Asisite group | ||||||||||||||||||
Asisite | Pb7SiO8Cl2 | tetr., I4/mmm | FOTO | IMA 1987-003 | ||||||||||||||
Parkinsonite | Pb7(Mo,□)O8Cl2 | tetr., I4/mmm | IMA 1991-030 | |||||||||||||||
Janchevite | Pb7V(O8.5□0.5)Cl2 | tetr., I4/mmm | IMA 2017-079 | |||||||||||||||
Asisite shows a superstructure, the real formula is probably Pb12(SiO4)O8Cl4. | ||||||||||||||||||
3.DE.060. Hereroite group | ||||||||||||||||||
Hereroite | [Pb32(O,□)21](AsO4)2[(Si,As,V,Mo)O4]2Cl10 | mon., C2/c | IMA 2011-027 | |||||||||||||||
Erikjonssonite | [Pb32O21][(V,Si,Mo,As)O4]4Cl9 | mon., C2/c | IMA 2018-058 | |||||||||||||||
3.DE.065. Mereheadite | ||||||||||||||||||
Mereheadite | Pb47O24(OH)13Cl25(BO3)2(CO3) | mon., C2/c | FOTO | IMA 1996-045 | ||||||||||||||
3.DE.070. Vladkrivovichevite | ||||||||||||||||||
Vladkrivovichevite | [Pb32O18][Pb4Mn2O]Cl14(BO3)8(H2O)2 | orth., Pmmn | IMA 2011-020 | |||||||||||||||
| ||||||||||||||||||
3.DF. Oxyhalides with Hg | ||||||||||||||||||
3.DF.005. Eglestonite group | ||||||||||||||||||
Eglestonite | Hg1+6O(OH)Cl3 | cub., Ia3d | FOTO | IMA 1992-046 | ||||||||||||||
Kadyrelite | Hg1+6O1.5Cl3 | cub., Ia3d | IMA 1986-042 | |||||||||||||||
3.DF.010. Poyarkovite | ||||||||||||||||||
Poyarkovite | Hg1+3OCl | mon., C2/c | IMA 1980-099 | |||||||||||||||
3.DF.015. Hanawaltite | ||||||||||||||||||
Hanawaltite | Hg1+Hg2+O3(Cl,OH)2 | orth., Pbma | IMA 1994-036 | |||||||||||||||
3.DF.020. Terlinguaite | ||||||||||||||||||
Terlinguaite | Hg1+Hg2+OCl | mon., C2/c | FOTO | G | ||||||||||||||
3.DF.025. Aurivilliusite | ||||||||||||||||||
Aurivilliusite | Hg1+Hg2+OI | mon., C2/m | IMA 2002-022 | |||||||||||||||
3.DF.030. Terlinguacreekite | ||||||||||||||||||
Terlinguacreekite | Hg2+3O2Cl2 | orth. subcell | IMA 2004-018 | |||||||||||||||
3.DF.035. Pinchite | ||||||||||||||||||
Pinchite | Hg2+5O4Cl2 | orth., Ibam | IMA 1973-052 | |||||||||||||||
3.DF.040. Mosesite group | ||||||||||||||||||
Mosesite | (Hg2N)2(Cl2,SO4,MoO4,CO3)·2H2O | cub., F43m | FOTO | G | ||||||||||||||
Gianellaite | (Hg2N)2(SO4) | cub., F43m | IMA 1972-020 | |||||||||||||||
3.DF.045. Kleinite | ||||||||||||||||||
Kleinite | (Hg2N)2(Cl2,SO4)·nH2O | hex., P63/mmc | FOTO | G | ||||||||||||||
3.DF.050. Tedhadleyite | ||||||||||||||||||
Tedhadleyite | Hg2+Hg1+10O4I2(Cl,Br)2 | tric., A1 | IMA 2001-035 | |||||||||||||||
3.DF.055. Vasilyevite | ||||||||||||||||||
Vasilyevite | (Hg2)2+10O6I3Br2Cl(CO3) | tric., P1 | IMA 2003-016 | |||||||||||||||
3.DF.060. Kelyanite | ||||||||||||||||||
Kelyanite | Hg1+16Hg2+20Sb3O28(Cl,Br)9 | mon., C2/m | IMA 1981-013 | |||||||||||||||
3.DF.065. Comancheite | ||||||||||||||||||
Comancheite | Hg2+55N3-24(NH2,OH)4(Cl,Br)34 | orth., Pnnm | FOTO | IMA 1980-077, Rd 2013-B | ||||||||||||||
3.DF.070. Gaildunningite | ||||||||||||||||||
Gaildunningite | Hg2+3(NHg2+2)18(Cl,I,OH,Br,S)24 | orth., Amam | IMA 2018-029 | |||||||||||||||
3.DF.075. Mikecoxite | ||||||||||||||||||
Mikecoxite | [CHg4]OCl2 | mon., P21/n | IMA 2021-060 | |||||||||||||||
| ||||||||||||||||||
3.DG. Oxyhalides with Alkalies and brucite-like layers | ||||||||||||||||||
3.DG.005. Koenenite | ||||||||||||||||||
Koenenite | [Mg7Al4(OH)22][Na4Mg2Cl12] | trig., 2 cells, R3m and P3m1 | FOTO | G | ||||||||||||||
Koenenite structure: alternating layers of brucite-like Mg-Al-hydroxide and halite-related Na-Mg-chloride, forming an incommensurate structure with two sublattices. | ||||||||||||||||||
| ||||||||||||||||||
3.DH. Oxyhalides with Alkalies and neutral As3+2O3 sheets | ||||||||||||||||||
3.DH.005. Torrecillasite | ||||||||||||||||||
Torrecillasite | Na(As,Sb)3+4O6Cl | orth., Pmcn | IMA 2013-112 | |||||||||||||||
3.DH.010. Lucabindiite group | ||||||||||||||||||
Lucabindiite | (K,NH4)(As3+2O3)2(Cl,Br) | hex., P6/mmm | IMA 2011-010 | |||||||||||||||
Ermakovite | (NH4)(As3+2O3)2Br | hex., P6/mmm | IMA 2020-054 | |||||||||||||||
Mauriziodiniite | (NH4)(As3+2O3)2I | hex., P6/mmm | IMA 2019-036 | |||||||||||||||
3.DH.015. Gajardoite group | ||||||||||||||||||
Gajardoite | KAs3+4O6Cl2[(Ca0.5□0.5)(H2O)5] | hex., P6/mmm | IMA 2015-040 | |||||||||||||||
Gajardoite-(NH4) | (NH4)As3+4O6Cl2[(Ca0.5□0.5)(H2O)5] | hex., P6/mmm | IMA 2023-070 | |||||||||||||||
3.DH.020. Russoite | ||||||||||||||||||
Russoite | (NH4)As3+2O3Cl(H2O)0.5 | hex., P622 | IMA 2015-105 | |||||||||||||||
3.DH.025. Cuatrocapaite group | ||||||||||||||||||
Cuatrocapaite-(K) | K3(NaMg□)(As3+2O3)6Cl6·16H2O | trig., R3m | IMA 2018-084 | |||||||||||||||
Cuatrocapaite-(NH4) | (NH4)3(NaMg□)(As3+2O3)6Cl6·16H2O | trig., R3m | IMA 2018-083 | |||||||||||||||
| ||||||||||||||||||
3.DJ. Oxyhalides with Rare Earth Elements | ||||||||||||||||||
3.DJ.005. Håleniusite | ||||||||||||||||||
Håleniusite-(La) | LaOF | cub., Fm3m | IMA 2003-028 | |||||||||||||||
Håleniusite-(Ce) | CeOF | cub., Fm3m | IMA 2021-042 | |||||||||||||||
| ||||||||||||||||||
3.DK. Oxyhalides with Actinides | ||||||||||||||||||
3.DK.005. Cabvinite | ||||||||||||||||||
Cabvinite | Th2F2(OH)·3H2O | tetr., I4/m | IMA 2016-011 | |||||||||||||||
3.DK.010. Uranoclite | ||||||||||||||||||
Uranoclite | (UO2)2(OH)2Cl2·4H2O | mon., P21/n | IMA 2020-074 | |||||||||||||||
3.DK.015. Nollmotzite | ||||||||||||||||||
Nollmotzite | MgU5+(UO2)O4F3·4H2O | mon., Cm | IMA 2017-100 | |||||||||||||||
G = Grandfathered minerals: original description preceded the establishment of the CNMNC in 1959, and generally regarded as a valid species A or IMA No. = Minerals approved by the CNMNC Rd = Redefinition of the mineral approved by the CNMNC Rn = Renamed with approval by the CNMNC Q = Questionable mineral Classification principles: Subdivision of the Halides subclass 3.D: Oxyhalides and Hydroxyhalides into 3.DA. Oxyhalides and Hydroxyhalides with Al; 3.DB. Oxyhalides and Hyroxyhalides with Cu (and/or Mg, Mn, Fe, Zn), without Pb; 3.DC. Oxyhalides and Hydroxyhalides with Pb and Cu, Ag or Fe; 3.DD. Oxyhalides and Hydroxyhalides with Pb (or Sb, Bi, Sn), without Cu; 3.DE. Layered Pb-Oxyhalides with (substituted) PbO-layers derived from litharge / massicot; 3.DF. Oxyhalides with Hg; 3.DG. Oxyhalides with Alkalies and brucite-like layers; 3.DH. Oxyhalides with Alkalies and neutral As3+2O3 sheets; 3.DJ. Oxyhalides with Rare Earth Elements; 3.DK. Oxyhalides with Actinides. Further classification:
To distinguish from classical Strunz numbering, on hierarchical "group" level, a numbering with 3 digits is used, like "3.DA.005. Zharchikhite", instead of 2 digits (like "3.DA.05.") in the Strunz system. © Thomas Witzke (2024) |
|
|
|