|
|
|
|
MINERAL CLASSIFICATION / SYSTEMATIK der MINERALE based on E.H. Nickel & M.C. Nichols (2009), H. Strunz & E.H. Nickel (2001), revised by Thomas Witzke (2022) 7. SULFATES (Sulfates, Selenates, Tellurates, Chromates, Molybdates, Wolframates) 7.D: Sulfates etc. with additional anions, with water | ||||||||||||||||||
| 7.DA. With only small to medium-sized cations, insular octahedra and finite groups of octahedra | ||||||||||||||||||
| 7.DA.005. Aubertite group | ||||||||||||||||||
| Svyashinite | MgAl(SO4)2F·14H2O | tric., P1 or P1 | IMA 1983-045 | |||||||||||||||
| Magnesioaubertite | MgAl(SO4)2Cl·14H2O | tric., P1 | IMA 1982-015 | |||||||||||||||
| Aubertite | CuAl(SO4)2Cl·14H2O | tric., P1 | IMA 1978-051 | |||||||||||||||
| 7.DA.010. Riotintoite | ||||||||||||||||||
| Riotintoite | Al(SO4)(OH)·3H2O | tric., P1 | IMA 2015-085 | |||||||||||||||
| 7.DA.015. Rostite group | ||||||||||||||||||
| Khademite | Al(SO4)F·5H2O | orth., Pcba | Rd | |||||||||||||||
| Rostite | Al(SO4)(OH)·5H2O | orth., Pcba | FOTO | Rd | ||||||||||||||
| 7.DA.020. Jurbanite | ||||||||||||||||||
| Jurbanite | Al(SO4)(OH)·5H2O | mon., P21/n | IMA 1974-023 | |||||||||||||||
| 7.DA.025. Rossiantonite | ||||||||||||||||||
| Rossiantonite | Al3(PO4)(SO4)2(OH)2·14H2O | tric., 1 | IMA 2012-056 | |||||||||||||||
| 7.DA.030. Amarantite group | ||||||||||||||||||
| Amarantite | Fe2O(SO4)2·7H2O | tric., P1 | G | |||||||||||||||
| Hohmannite | Fe2O(SO4)2·8H2O | tric., P1 | G | |||||||||||||||
| Metahohmannite | Fe2O(SO4)2·4H2O | (?) | G | |||||||||||||||
| 7.DA.035. Bobjonesite | ||||||||||||||||||
| Bobjonesite | VO(SO4)·3H2O | mon. | IMA 2000-045 | |||||||||||||||
| 7.DA.040. Minasragrite group | ||||||||||||||||||
| Minasragrite | VO(SO4)·5H2O | mon. | FOTO | IMA 1974-023 | ||||||||||||||
| Orthominasragrite | VO(SO4)·5H2O | Pmn21 | IMA 2000-018 | |||||||||||||||
| Anorthominasragrite | VO(SO4)·5H2O | tric., P1 | IMA 2001-040 | |||||||||||||||
| 7.DA.045. Stanleyite | ||||||||||||||||||
| Stanleyite | VO(SO4)·6H2O | orth. | IMA 1980-042 | |||||||||||||||
| 7.DA.050. Copiapite group | ||||||||||||||||||
| Magnesiocopiapite | MgFe3+4(SO4)6(OH)2·20H2O | tric., P1 | G | |||||||||||||||
| Copiapite | Fe2+Fe3+4(SO4)6(OH)2·20H2O | tric., P1 | FOTO | G | ||||||||||||||
| Cuprocopiapite | CuFe3+4(SO4)6(OH)2·20H2O | tric., P1 | G | |||||||||||||||
| Zincocopiapite | ZnFe3+4(SO4)6(OH)2·20H2O | tric., P1 | G | |||||||||||||||
| Calciocopiapite | CaFe3+4(SO4)6(OH)2·20H2O | tric., P1 | A | |||||||||||||||
| Aluminocopiapite | (Al,Mg)Fe3+4(SO4)6(OH,O)2·20H2O | tric., P1 | FOTO | G | ||||||||||||||
| Ferricopiapite | (Fe3+)0.67Fe3+4(SO4)6(OH)2·20H2O | tric., P1 | G | |||||||||||||||
| 7.DA.055. Cossaite | ||||||||||||||||||
| Cossaite | (Mg0.5,□)Al6(SO4)6(HSO4)F6·36H2O | trig., R3 | IMA 2009-031 | |||||||||||||||
| 7.DA.060. Bouškaite | ||||||||||||||||||
| Bouškaite | (MoO2)2O(SO3OH)2(H2O)6 | tric., P1 | IMA 2018-055a | |||||||||||||||
| 7.DA.065. Ramazzoite | ||||||||||||||||||
| Ramazzoite | [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0.33SO4)3(H2O)36] | |||||||||||||||||
| cub., P43m | IMA 2017-090 | |||||||||||||||||
|
The crystal structure of Ramazzoite contains cationic polyoxometalate (POM) units of Mg and Cu centered octahedra, a phosphate group and carbonate groups, [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20]5+. The units are connected via sulfate groups and water. | ||||||||||||||||||
| ||||||||||||||||||
| 7.DB. With only small to medium-sized cations, chains of corner-sharing or edge-sharing octahedra | ||||||||||||||||||
| 7.DB.005. Aluminite group | ||||||||||||||||||
| Aluminite | Al2(SO4)(OH)4·7H2O | mon., P21/b | FOTO | G | ||||||||||||||
| Meta-aluminite | Al2(SO4)(OH)4·5H2O | (?) | IMA 1967-013 | |||||||||||||||
| 7.DB.010. Vendidaite | ||||||||||||||||||
| Vendidaite | Al2(SO4)(OH)3Cl·6H2O | mon., C2/c | IMA 2012-089 | |||||||||||||||
| 7.DB.015. Butlerite group | ||||||||||||||||||
| Butlerite | Fe3+(SO4)(OH)·2H2O | mon., P21/m | G | |||||||||||||||
| Parabutlerite | Fe3+(SO4)(OH)·2H2O | orth. | G | |||||||||||||||
| 7.DB.020. Fibroferrite | ||||||||||||||||||
| Fibroferrite | Fe3+(SO4)(OH)·5H2O | trig., R3 | FOTO | G | ||||||||||||||
| 7.DB.025. Xitieshanite | ||||||||||||||||||
| Xitieshanite | Fe3+(SO4)Cl·6H2O | mon., P21/a | IMA 1982-044 | |||||||||||||||
| 7.DB.030. Volaschioite | ||||||||||||||||||
| Volaschioite | Fe3+4(SO4)O2(OH)6·2H2O | mon., C2/m | IMA 2010-005 | |||||||||||||||
| 7.DB.035. Botryogen group | ||||||||||||||||||
| Botryogen | MgFe3+(SO4)2(OH)·7H2O | mon., P21/n | G | |||||||||||||||
| Zincobotryogen | ZnFe3+(SO4)2(OH)·7H2O | mon., P21/n | IMA 2015107 | |||||||||||||||
| 7.DB.040. Guildite group | ||||||||||||||||||
| Guildite | CuFe3+(SO4)2(OH)·4H2O | mon., P21/m | G | |||||||||||||||
| Chaidamuite | ZnFe3+(SO4)2(OH)·4H2O | tric., P1 | IMA 1985-011 | |||||||||||||||
| 7.DB.045. Cyanotrichite group | ||||||||||||||||||
| Cyanotrichite | [Cu2Al(OH)6]2(SO4)·2H2O | mon., C2/m | FOTO | A | ||||||||||||||
| Carbonatecyanotrichite | [Cu2Al(OH)6]2(CO3)·2H2O | mon. (?) | FOTO | Rn | ||||||||||||||
| Camérolaite | [Cu2Al(OH)6]3[Sb(OH)6](SO4)·2H2O | tric., P1 | FOTO | IMA 1990-036, Rn | ||||||||||||||
| 7.DB.050. Redgillite | ||||||||||||||||||
| Redgillite | Cu6(SO4)(OH)10·H2O | mon., P21/b | IMA 2004-016 | |||||||||||||||
| 7.DB.055. Montetrisaite | ||||||||||||||||||
| Montetrisaite | Cu6(SO4)(OH)10·2H2O | orth., Cmc21 | IMA 2007-009 | |||||||||||||||
| 7.DB.060. Isselite | ||||||||||||||||||
| Isselite | Cu6(SO4)(OH)10·5H2O | orth., Pmn21 | IMA 2018-139 | |||||||||||||||
| ||||||||||||||||||
| 7.DC. With only small to medium-sized cations, sheets of edge-sharing octahedra | ||||||||||||||||||
| 7.DC.005. Felsöbányaite | ||||||||||||||||||
| Felsöbányaite | Al4(SO4)(OH)10·5H2O | hex. | G | |||||||||||||||
|
Felsöbányaite: stepped layers of edge- and corner-sharing AlO6 octahedra, with sulfate and water in the interlayer. | ||||||||||||||||||
| 7.DC.010. Hydrobasaluminite | ||||||||||||||||||
| Hydrobasaluminite | Al4(SO4)(OH)10·15H2O | mon. | G | |||||||||||||||
| 7.DC.015. Chalcoalumite group | ||||||||||||||||||
| Chalcoalumite | CuAl4(SO4)(OH)12·3H2O | mon., P21 | G | |||||||||||||||
| Kyrgyzstanite | ZnAl4(SO4)(OH)12·3H2O | mon. | IMA 2004-024 | |||||||||||||||
| Nickelalumite | NiAl4(SO4,(NO3)2)(OH)12·3H2O | mon. | - | |||||||||||||||
| Mbobomkulite | (Ni,Cu)Al4(NO3,SO4)(OH)12·3H2O | mon. | IMA 1979-078 | |||||||||||||||
|
Chalcoalumite: layers of edge-sharing AlO6 and CuO6 octahedra, 1/6th of the octahedra are not occupied, forming the unit [□Cu2+Al4(OH)12]2+. The interlayer contains sulfate and water, [(SO4)(H2O)3]2- (Hawthorne & Cooper, 2013). | ||||||||||||||||||
| 7.DC.020. Posnjakite | ||||||||||||||||||
| Posnjakite | Cu4(SO4)(OH)6·H2O | mon., C2/c | FOTO | IMA 1967-001 | ||||||||||||||
|
Posnjakite: layers of edge-sharing CuO6 octahedra, decorated with sulfate tetrahedra on one side of the layer. The sulfate share one oxygen at a corner with the octahedral layer. | ||||||||||||||||||
| 7.DC.025. Langite group | ||||||||||||||||||
| Langite | Cu4(SO4)(OH)6·2H2O | mon., Pc | G | |||||||||||||||
| Wroewolfeite | Cu4(SO4)(OH)6·2H2O | mon., Pc | FOTO | IMA 1973-064 | ||||||||||||||
|
Langite and Wroewolfeite: layers of edge-sharing CuO6 octahedra, decorated with sulfate tetrahedra on one side of the layer. The sulfate share one oxygen at a corner with the octahedral layer. | ||||||||||||||||||
| 7.DC.030. Spangolite group | ||||||||||||||||||
| Spangolite | Cu6Al(SO4)(OH)12Cl·3H2O | trig., P31c | FOTO | G | ||||||||||||||
| Llantenesite | Cu6Al(SeO4)(OH)12Cl·3H2O | trig., P31c | IMA 2018-111 | |||||||||||||||
|
Spangolite: layers of edge-sharing octahedra, decorated with sulfate tetrahedra on one side of the layer. The sulfate share one oxygen at a corner with the octahedral layer. The interlayer contains chlorine and water. | ||||||||||||||||||
| 7.DC.035. Schulenbergite | ||||||||||||||||||
| Schulenbergite | (Cu,Zn)7(SO4)2(OH)10·3H2O | trig., P3 or P3 | FOTO | IMA 1982-074 | ||||||||||||||
|
Schulenbergite: layers of edge-sharing octahedra, decorated with sulfate tetrahedra on both sides of the layer. The sulfate share one oxygen at a corner with the octahedral layer. The interlayer contains only water. | ||||||||||||||||||
| 7.DC.040. Minohlite | ||||||||||||||||||
| Minohlite | (Cu,Zn)7(SO4)2(OH)10·8H2O | hex. | IMA 2012-035 | |||||||||||||||
|
Minohlite is probably a higher hydrate of SChulenbergite. | ||||||||||||||||||
| 7.DC.045. Christelite | ||||||||||||||||||
| Christelite | ZnZn2Cu2(SO4)2(OH)6·4H2O | tric., P1 | IMA 1995-030 | |||||||||||||||
|
Christelite: layers of edge-sharing octahedra, decorated with sulfate tetrahedra on both sides of the layer. The sulfate share one oxygen at a corner with the octahedral layer. The interlayer contains cations and water. The structural formula of Christelite can be written as [Zn(H2O)4][Zn2Cu2(OH)6(SO4)2]. | ||||||||||||||||||
| 7.DC.050. Ktenasite group | ||||||||||||||||||
| Fehrite | MgCu4(SO4)2(OH)6·6H2O | mon., P21/c | IMA 2018-125a | |||||||||||||||
| Ktenasite | ZnCu4(SO4)2(OH)6·6H2O | mon., P21/c | FOTO | G | ||||||||||||||
| Gobelinite | CoCu4(SO4)2(OH)6·6H2O | mon., P21/c | IMA 2018-167 | |||||||||||||||
|
Ktenasite and other members of the group: layers of edge-sharing octahedra, decorated with sulfate tetrahedra on both sides of the layers. The sulfate share one oxygen at a corner with the octahedral layer. The interlayer contains cations and water. The structural formula of Ktenasite can be written as [Zn(H2O)6][Cu4(OH)6(SO4)2]. | ||||||||||||||||||
| 7.DC.55. Lawsonbauerite group | ||||||||||||||||||
| Torreyite | Mg9Zn4(SO4)2(OH)22·8H2O | mon., P21/a | G | |||||||||||||||
| Lawsonbauerite | Mn9Zn4(SO4)2(OH)22·8H2O | mon., P21/c | A | |||||||||||||||
|
Torreyite, Lawsonbauerite: layers of edge-sharing MeO6 octahedra, the octahedral vacancies are capped on both sides of the layer with ZnO4 tetrahedra. Three corners of the tetrahedra share oxygen with the octahedra of the main layer. The 4th corner of the tetrahedra is pointing into the interlayer and is shared with a corner from the (Mg/Mn)(O/H2O)6 octahedra in the interlayer. | ||||||||||||||||||
| 7.DC.60. Mooreite | ||||||||||||||||||
| Mooreite | Mg15(SO4)2(OH)26·8H2O | mon., P21/m | G | |||||||||||||||
|
Mooreite: similar structure as in Torreyite and Lawsonbauerite. | ||||||||||||||||||
| 7.DC.065. Lahnsteinite | ||||||||||||||||||
| Lahnsteinite | Zn4(SO4)(OH)6·3H2O | tric., P1 | IMA 2012-002 | |||||||||||||||
|
Lahnsteinite: layers of edge-sharing ZnO6 octahedra, the octahedral vacancies are capped on both sides of the layer with ZnO4 tetrahedra. Three corners of the tetrahedra share oxygen with the octahedra, the 4th corner of the tetrahedra is pointing into the interlayer. Additionally, the layers are decorated with sulfate tetrahedra on both sides. The sulfate share one oxygen at a corner with the octahedral layer. The interlayer contains only water. | ||||||||||||||||||
| 7.DC.070. Namuwite | ||||||||||||||||||
| Namuwite | Zn4(SO4)(OH)6·4H2O | trig., P3 | FOTO | A | ||||||||||||||
|
Namuwite: layers of edge-sharing ZnO6 octahedra, the octahedral vacancies are capped on both sides of the layer with ZnO4 tetrahedra. Three corners of the tetrahedra share oxygen with the octahedra, the 4th corner of the tetrahedra is pointing into the interlayer. Additionally, the layers are decorated with sulfate tetrahedra on both sides. The sulfate share one oxygen at a corner with the octahedral layer. The interlayer contains only water. | ||||||||||||||||||
| 7.DC.075. Osakaite | ||||||||||||||||||
| Osakaite | Zn4(SO4)(OH)6·5H2O | tric., P1 | IMA 2006-049 | |||||||||||||||
|
Osakaite: layers of edge-sharing ZnO6 octahedra, the octahedral vacancies are capped on both sides of the layer with ZnO4 tetrahedra. Three corners of the tetrahedra share oxygen with the octahedra, the 4th corner of the tetrahedra is pointing into the interlayer. Additionally, the layers are decorated with sulfate tetrahedra on both sides. The sulfate share one oxygen at a corner with the octahedral layer. The interlayer contains only water. | ||||||||||||||||||
| 7.DC.080. Hodgesmithite | ||||||||||||||||||
| Hodgesmithite | (Cu,Zn)6Zn(SO4)2(OH)10·3H2O | trig., P3 | IMA 2015-112 | |||||||||||||||
|
Hodgesmithite: layers of edge-sharing octahedra, with the octahedral vacancies capped on both sides of the layer with tetrahedra. Connection to the next layer by corner-sharing of adjacent tetrahedra. Sulfate tetrahedra share a corner with oxygen from octahedra in the main layer. | ||||||||||||||||||
| 7.DC.085. Ramsbeckite | ||||||||||||||||||
| Ramsbeckite | Cu15(SO4)4(OH)22·6H2O | mon., P21/a | FOTO | A | ||||||||||||||
|
Ramsbeckite: layers of edge-sharing octahedra, with the octahedral vacancies capped on both sides of the layer with tetrahedra. Connection to the next layer by corner-sharing of adjacent tetrahedra. Sulfate tetrahedra share a corner with oxygen from octahedra in the main layer. | ||||||||||||||||||
| 7.DC.090. Hanahanite | ||||||||||||||||||
| Hanahanite | Zn8(SO4)(OH)14·3H2O | hex., P63 | IMA 2022-012 | |||||||||||||||
|
Hanahanite: layers of edge-sharing octahedra, with the octahedral vacancies capped on both sides of the layer with tetrahedra. Connection to the next layer by corner-sharing of adjacent tetrahedra. Sulfate tetrahedra share a corner with oxygen from octahedra in the main layer. | ||||||||||||||||||
| 7.DC.095. Bechererite | ||||||||||||||||||
| Bechererite | (Zn,Cu)6Zn2(OH)13((S,Si)(O,OH)4)2 | trig., P31c | IMA 1994-005 | |||||||||||||||
|
Bechererite: layers of edge-sharing octahedra, with the octahedral vacancies capped on both sides of the layer with tetrahedra. Connection to the next layer by corner-sharing of adjacent tetrahedra. Sulfate / silicate tetrahedra share a corner with oxygen from octahedra in the main layer. | ||||||||||||||||||
| ||||||||||||||||||
| 7.DD. With only small to medium-sized cations, three-dimensional framework of octahedra | ||||||||||||||||||
| 7.DD.005. Schwertmannite | ||||||||||||||||||
| Schwertmannite | Fe16O16(OH)9.6(SO4)3.2·10H2O | mon., ps.-tetr. | FOTO | IMA 1990-006 | ||||||||||||||
| ||||||||||||||||||
| 7.DE. With only small to medium-sized cations, other types of polyhedra | ||||||||||||||||||
| 7.DE.005. Coquandite | ||||||||||||||||||
| Coquandite | Sb3+6+XO8+X(SO4)(OH)X(H2O)1-X (X = 0.3) | mon., ps.-tetr. | FOTO | IMA 1991-024 | ||||||||||||||
| ||||||||||||||||||
| 7.DF. With only small to medium-sized cations, unclassified | ||||||||||||||||||
| 7.DF.005. Mangazeite | ||||||||||||||||||
| Mangazeite | Al2(SO4)(OH)4·3H2O | tric. | IMA 2005-021a | |||||||||||||||
| 7.DF.010. Zaherite | ||||||||||||||||||
| Zaherite | Al12(SO4)5(OH)26·20H2O | tric., P1 or P1 | IMA 1977-002 | |||||||||||||||
| 7.DF.015. Wilcoxite | ||||||||||||||||||
| Wilcoxite | MgAl(SO4)2F·18H2O | tric., P1 or P1 | FOTO | IMA 1979-070 | ||||||||||||||
| 7.DF.020. Guarinoite | ||||||||||||||||||
| Guarinoite | Zn6(SO4)(OH)10·5H2O | hex., P63 or other | IMA 1991-005 | |||||||||||||||
| ||||||||||||||||||
| 7.DG. With large and small to medium-sized cations, insular octahedra and finite groups of octahedra | ||||||||||||||||||
| 7.DG.005. Kainite | ||||||||||||||||||
| Kainite | KMg(SO4)Cl·2.75H2O | mon., C2/m | FOTO | G | ||||||||||||||
| 7.DG.010. Fleischerite group | ||||||||||||||||||
| Despujolsite | Ca3Mn(SO4)2(OH)6·3H2O | hex. P62c | IMA 1967-039 | |||||||||||||||
| Schaurteite | Ca3Ge(SO4)2(OH)6·3H2O | hex. P63/mmc | A | |||||||||||||||
| Genplesite | Ca3Sn(SO4)2(OH)6·3H2O | hex. P63/mmc | IMA 2014-034 | |||||||||||||||
| Fleischerite | Pb3Ge(SO4)2(OH)6·3H2O | hex. P63/mmc | A | |||||||||||||||
| Mallestigite | Pb3Sb(SO4)(AsO4)(OH)6·3H2O | hex. P63/mmc | FOTO | IMA 1996-043 | ||||||||||||||
| 7.DG.015. Karpovite | ||||||||||||||||||
| Karpovite | Tl2VO(SO4)2·H2O | mon., P21 | IMA 2013-040 | |||||||||||||||
| 7.DG.020. Evdokimovite | ||||||||||||||||||
| Evdokimovite | Tl2VO(SO4)2·5H2O | mon., P21/n | IMA 2013-041 | |||||||||||||||
| 7.DG.025. Metavoltine group | ||||||||||||||||||
| Giacovazzoite | K5[Fe3+3O(SO4)6]·10H2O | mon., P21/c | IMA 2018-165 | |||||||||||||||
| Carlsonite | (NH4)5[Fe3+3O(SO4)6]·7H2O | tric., P1 | IMA 2014-067 | |||||||||||||||
| Metavoltine | K2Na6Fe2+[Fe3+3O(SO4)6]2·18H2O | trig., P3 | FOTO | G | ||||||||||||||
| Scordariite | K8Fe3+0.67[Fe3+3O(SO4)6]2·14H2O | trig., R3 | IMA 2019-010 | |||||||||||||||
|
With [Fe3+3O(SO4)6(H2O)3]5--clusters. | ||||||||||||||||||
| 7.DG.030. Huizingite-(Al) | ||||||||||||||||||
| Huizingite-(Al) | [(NH4)5(SO4)2][(Al,Fe3+)3(OH)2(H2O)4(SO4)6] | tric., P1 | IMA 2015-014 | |||||||||||||||
| 7.DG.035. Lannonite group | ||||||||||||||||||
| Lannonite | Ca4Mg2Al4(SO4)8F8·24H2O | tetr., I4/m | IMA 1979-069 | |||||||||||||||
| Vlodavetsite | Ca2Al(SO4)2F2Cl·4H2O | tetr., I4/m | IMA 1993-023 | |||||||||||||||
| ||||||||||||||||||
| 7.DH. With large and small to medium-sized cations, chains of corner-sharing or edge-sharing octahedra | ||||||||||||||||||
| 7.DH.005. Uklonskovite | ||||||||||||||||||
| Uklonskovite | NaMg(SO4)(OH)·2H2O | mon., P21/m | A | |||||||||||||||
| 7.DH.010. Natrochalcite | ||||||||||||||||||
| Natrochalcite | NaCu2(SO4)2(OH)·H2O | mon., C2/m | G | |||||||||||||||
| Kaliochalcite | KCu2(SO4)2(OH)·H2O | mon., C2/m | IMA 2013-037 | |||||||||||||||
| 7.DH.015. Sideronatrite group | ||||||||||||||||||
| Sideronatrite | Na2Fe3+(SO4)2(OH)·3H2O | orth., Pnnm (?) | G | |||||||||||||||
| Metasideronatrite | Na2Fe3+(SO4)2(OH)·H2O | orth., Pbnm | FOTO | G | ||||||||||||||
| 7.DH.020. Calamaite | ||||||||||||||||||
| Calamaite | Na2Ti4+(SO4)2O·2H2O | orth., | IMA 2016-036 | |||||||||||||||
| 7.DH.025. Slavikite | ||||||||||||||||||
| Slavikite | (H3O)Mg6Fe3+15(SO4)21(OH)18·98H2O | trig., R3 | FOTO | IMA 1967-039, Rd | ||||||||||||||
| 7.DH.030. Bridgesite-(Ce) | ||||||||||||||||||
| Bridgesite-(Ce) | CaCe2Cu6(SO4)4(OH)12·8H2O | mon., C2/m | IMA 2019-034 | |||||||||||||||
| 7.DH.035. Cherokeeite | ||||||||||||||||||
| Cherokeeite | Pb2Zn(SO4)(OH)4·H2O | mon., P21/n | IMA 2022-016 | |||||||||||||||
| ||||||||||||||||||
| 7.DJ. With large and small to medium-sized cations, sheets of edge-sharing octahedra | ||||||||||||||||||
| 7.DJ.005. Gordaite group | ||||||||||||||||||
| Gordaite | NaZn4(SO4)(OH)6Cl·6H2O | trig., P3 | FOTO | IMA 1996-006 | ||||||||||||||
| Thérèsemagnanite | NaCo4(SO4)(OH)6Cl·6H2O | trig., P3 | IMA 1991-026, Rd | |||||||||||||||
| 7.DJ.010. Haywoodite | ||||||||||||||||||
| Haywoodite | PbZn12(SO4)3(OH)20·11H2O | tric., P1 | IMA 2021-115 | |||||||||||||||
|
Haywoodite is structurally related to Gordaite. A structural formula showing the layer content is [Pb(H2O)10][Zn12(OH)20(H2O)(SO4)3]. | ||||||||||||||||||
| 7.DJ.015. Devilline group | ||||||||||||||||||
| Devilline | CaCu4(SO4)2(OH)6·3H2O | mon., P21/c | FOTO | A | ||||||||||||||
| Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6·3H2O | mon., C2/c | G | |||||||||||||||
| Aldridgeite | (Cd,Ca)(Cu,Zn)4(SO4)2(OH)6·3H2O | mon., C2/c | IMA 2010-029 | |||||||||||||||
| Orthoserpierite | CaCu4(SO4)2(OH)6·3H2O | orth., Pca21 | IMA 1983-022 | |||||||||||||||
| Lautenthalite | PbCu4(SO4)2(OH)6·3H2O | mon., P21/b | IMA 1983-029 | |||||||||||||||
| Kobyashevite | CuCu4(SO4)2(OH)6·4H2O | tric., P1 | IMA 2011-066 | |||||||||||||||
| Campigliaite | MnCu4(SO4)2(OH)6·4H2O | mon., Cc | IMA 1981-001 | |||||||||||||||
| Niedermayrite | CdCu4(SO4)2(OH)6·4H2O | mon., P21/m | IMA 1997-024 | |||||||||||||||
| Edwardsite | Cd2Cu3(SO4)2(OH)6·4H2O | mon., P21/c | IMA 2009-048 | |||||||||||||||
| 7.DJ.020. Lauraniite | ||||||||||||||||||
| Lauraniite | Cd2Cu6(SO4)2(OH)12·5H2O | mon., P21/c | IMA 2019-049 | |||||||||||||||
| ||||||||||||||||||
| 7.DK. With large and small to medium-sized cations, other polyhedra | ||||||||||||||||||
| 7.DK.005. Peretaite | ||||||||||||||||||
| Peretaite | CaSb3+4O4(SO4)2(OH)2·2H2O | mon., C2/c | FOTO | IMA 1979-068 | ||||||||||||||
| 7.DK.010. Elyite | ||||||||||||||||||
| Elyite | CuPb4O2(SO4)(OH)4·H2O | mon., P21/c | FOTO | IMA 1971-043 | ||||||||||||||
| 7.DK.015. Sulfatoredmondite | ||||||||||||||||||
| Sulfatoredmondite | [Pb8O2Zn(OH)6](SO4)4·6H2O | mon., C2/m | IMA 2021-089 | |||||||||||||||
|
Sulfatoredmondite is closely related to the thiosulfates redmondite and hydroredmondite, but not isostructural. | ||||||||||||||||||
| ||||||||||||||||||
| 7.DL. With large and small to medium-sized cations, unclassified | ||||||||||||||||||
| 7.DL.005. Clairite | ||||||||||||||||||
| Clairite | (NH4)2Fe3(SO4)4(OH)3·3H2O | tric. | FOTO | IMA 1982-093 | ||||||||||||||
| 7.DL.010. Alcaparossaite group | ||||||||||||||||||
| Alcaparossaite | K3Ti4+Fe3+(SO4)4O·2H2O | mon., C2/c | IMA 2011-024 | |||||||||||||||
| Magnanelliite | K3Fe3+2(SO4)4(OH)·2H2O | mon., C2/c | IMA 2019-006 | |||||||||||||||
| 7.DL.015. Vonbezingite | ||||||||||||||||||
| Vonbezingite | Ca6Cu3(SO4)3(OH)12·2H2O | mon., P21/c | IMA 1991-031 | |||||||||||||||
| 7.DL.020. Arzrunite | ||||||||||||||||||
| Arzrunite | Pb2Cu4(SO4)(OH)4Cl6·2H2O (?) | Q | ||||||||||||||||
| ||||||||||||||||||
| 7.DM. With only large cations | ||||||||||||||||||
| 7.DM.005. Riomarinaite | ||||||||||||||||||
| Riomarinaite | Bi(SO4)(OH)·H2O | mon., P21/n | IMA 2000-004 | |||||||||||||||
| ||||||||||||||||||
| 7.DN. With medium-sized and/or large cations, with NO3, IO3, CO3, B(OH)4, SeO3, or SiO4 | ||||||||||||||||||
| 7.DN.005. Darapskite | ||||||||||||||||||
| Darapskite | Na3(SO4)(NO3)·H2O | mon., P21/m | FOTO | Rd | ||||||||||||||
| 7.DN.010. Ungemachite group | ||||||||||||||||||
| Humberstonite | K3Na7Mg2(SO4)6(NO3)2·6H2O | trig., R3 | IMA 1967-015 | |||||||||||||||
| Ungemachite | K3Na8Fe3+(SO4)6(NO3)2·6H2O | trig., R3 | G | |||||||||||||||
| Clinoungemachite | K3Na8Fe3+(SO4)6(OH)2·10H2O | mon., ps.-hex. | G | |||||||||||||||
| 7.DN.015. Witzkeite | ||||||||||||||||||
| Witzkeite | K4Na4Ca(SO4)4(NO3)2·2H2O | mon., Cc | FOTO | IMA 2011-084 | ||||||||||||||
| 7.DN.020. Fuenzalidaite group | ||||||||||||||||||
| Fuenzalidaite | K3Na5Mg5(SO4)6(IO3)6·6H2O | trig., P3c1 | FOTO | IMA 1993-021 | ||||||||||||||
| Carlosruizite | K3Na5Mg5(SeO4)6(IO3)6·6H2O | trig., P3c1 | IMA 1993-020 | |||||||||||||||
| 7.DN.025. Ettringite group | ||||||||||||||||||
| Ettringite | Ca6Al2(SO4)3(OH)12·26H2O | trig., P31c | A | |||||||||||||||
| Siwaqaite | Ca6Al2(CrO4)3(OH)12·24H2O | trig., P31c | IMA 2018-150 | |||||||||||||||
| Bentorite | Ca6Cr2(SO4)3(OH)12·26H2O | hex. | FOTO | IMA 1979-042 | ||||||||||||||
| Charlesite | Ca6Al2(SO4)2(B(OH)4)(OH,O)12·26H2O | trig., P31c | IMA 1981-043 | |||||||||||||||
| Tatarinovite | Ca6Al2(SO4)2(B(OH)4)2(OH)12·24H2O | hex., P63 | IMA 2015-055 | |||||||||||||||
| Sturmanite | Ca6Fe3+2(SO4)2.5(B(OH)4)(OH)12·25H2O | trig., P31c | IMA 1981-011 | |||||||||||||||
| Thaumasite | Ca6Si4+2(SO4)2(CO3)2(OH)12·24H2O | hex., P63 | FOTO | G | ||||||||||||||
| Carraraite | Ca6Ge4+2(SO4)2(CO3)2(OH)12·24H2O | hex., P63/m | IMA 1998-002 | |||||||||||||||
| Jouravskite | Ca6Mn4+2(SO4)2(CO3)2(OH)12·24H2O | hex., P63 | IMA 1965-009 | |||||||||||||||
| Hielscherite | Ca6Si4+2(SO4)2(SO3)2(OH)12·22H2O | hex., P63 | IMA 2011-037 | |||||||||||||||
| Kottenheimite | Ca6Si4+2(SO4)2(SO4)2(OH)12·24H2O | hex., P63/m | IMA 2011-038 | |||||||||||||||
| Buryatite | Ca6(Si,Fe3+,Al)2(SO4)2(B(OH)4)(OH,O)12·24H2O | trig., P31c | FOTO | IMA 2000-021 | ||||||||||||||
|
For the carbonate-dominant members of the Ettringite group, see Micheelsenite group, 5.DB.55. | ||||||||||||||||||
| 7.DN.030. Rapidcreekite | ||||||||||||||||||
| Rapidcreekite | Ca2(SO4)(CO3)·4H2O | orth., Pcnb | FOTO | A | ||||||||||||||
| 7.DN.035. Tatarskite | ||||||||||||||||||
| Tatarskite | Ca6Mg2(SO4)2(CO3)2(OH)4Cl4·7H2O | (?) | A | |||||||||||||||
| 7.DN.040. Nakauriite | ||||||||||||||||||
| Nakauriite | Cu8(SO4)4(CO3)(OH)6·48H2O | orth. | FOTO | IMA 1976-016 | ||||||||||||||
| 7.DN.045. Pauladamsite | ||||||||||||||||||
| Pauladamsite | Cu4(SO4)(SeO3)(OH)4·2H2O | tric., P1 | FOTO | IMA 2015-005 | ||||||||||||||
| 7.DN.050. Chessexite | ||||||||||||||||||
| Chessexite | Na4Ca2Mg3Al8(SO4)10(SiO4)2(OH)10·40H2O | orth. | IMA 1981-054 | |||||||||||||||
| ||||||||||||||||||
|
G = Grandfathered minerals: original description preceded the establishment of the CNMNC in 1959, and generally regarded as a valid species A or IMA No. = Minerals approved by the CNMNC Rd = Redefinition of the mineral approved by the CNMNC Rn = Renamed with approval by the CNMNC Q = Questionable mineral © Thomas Witzke (2022) | ||||||||||||||||||
|
|
|